C19H25NO3 — CID 90870228
4-[hydroxy(phenyl)methyl]-2-(piperidin-1-ylmethyl)cyclohexane-1,3-dione (PubChem CID 90870228) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 4-[hydroxy(phenyl)methyl]-2-(piperidin-1-ylmethyl)cyclohexane-1,3-dione.
| Compound Name | 4-[hydroxy(phenyl)methyl]-2-(piperidin-1-ylmethyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 90870228 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 4-[hydroxy(phenyl)methyl]-2-(piperidin-1-ylmethyl)cyclohexane-1,3-dione |
| SMILES | O=C1CCC(C(O)c2ccccc2)C(=O)C1CN1CCCCC1 |
| InChI | InChI=1S/C19H25NO3/c21-17-10-9-15(18(22)14-7-3-1-4-8-14)19(23)16(17)13-20-11-5-2-6-12-20/h1,3-4,7-8,15-16,18,22H,2,5-6,9-13H2 |
| InChIKey | IIQARBTZPKQYPG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|