C13H18O8 — CID 90870380
2-hydroxy-1-[(2S,3R,4S,5R,6S)-3,4,5-trihydroxy-6-methoxy-5-prop-2-enoyloxan-2-yl]but-3-en-1-one (PubChem CID 90870380) has the molecular formula C13H18O8 and a molecular weight of 302.28 g/mol. Its IUPAC name is 2-hydroxy-1-[(2S,3R,4S,5R,6S)-3,4,5-trihydroxy-6-methoxy-5-prop-2-enoyloxan-2-yl]but-3-en-1-one.
| Compound Name | 2-hydroxy-1-[(2S,3R,4S,5R,6S)-3,4,5-trihydroxy-6-methoxy-5-prop-2-enoyloxan-2-yl]but-3-en-1-one |
|---|---|
| PubChem CID | 90870380 |
| Molecular Formula | C13H18O8 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2-hydroxy-1-[(2S,3R,4S,5R,6S)-3,4,5-trihydroxy-6-methoxy-5-prop-2-enoyloxan-2-yl]but-3-en-1-one |
| SMILES | C=CC(=O)[C@]1(O)[C@@H](OC)O[C@H](C(=O)C(O)C=C)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H18O8/c1-4-6(14)8(16)10-9(17)11(18)13(19,7(15)5-2)12(20-3)21-10/h4-6,9-12,14,17-19H,1-2H2,3H3/t6?,9-,10+,11-,12-,13+/m0/s1 |
| InChIKey | TUXCEBYOISCUJQ-NJZXRDRISA-N |
| XLogP | -2.32 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|