C24H31ClO7 — CID 90870908
chloromethyl (10R,11S,13S,17R)-17-ethoxycarbonyloxy-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-4H-cyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 90870908) has the molecular formula C24H31ClO7 and a molecular weight of 466.96 g/mol. Its IUPAC name is chloromethyl (10R,11S,13S,17R)-17-ethoxycarbonyloxy-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-4H-cyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | chloromethyl (10R,11S,13S,17R)-17-ethoxycarbonyloxy-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-4H-cyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 90870908 |
| Molecular Formula | C24H31ClO7 |
| Molecular Weight | 466.96 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | chloromethyl (10R,11S,13S,17R)-17-ethoxycarbonyloxy-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-4H-cyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | CCOC(=O)O[C@]1(C(=O)OCCl)CCC2C3CC=C4CC(=O)C=C[C@]4(C)C3C(O)C[C@@]21C |
| InChI | InChI=1S/C24H31ClO7/c1-4-30-21(29)32-24(20(28)31-13-25)10-8-17-16-6-5-14-11-15(26)7-9-22(14,2)19(16)18(27)12-23(17,24)3/h5,7,9,16-19,27H,4,6,8,10-13H2,1-3H3/t16?,17?,18?,19?,22-,23-,24-/m0/s1 |
| InChIKey | FBBYEJJQINKJNE-QMVKLYBFSA-N |
| XLogP | 3.92 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.96 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|