C16H23NO7 — CID 90871071
[1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-2-methylpropyl] cyclohexanecarboxylate (PubChem CID 90871071) has the molecular formula C16H23NO7 and a molecular weight of 341.36 g/mol. Its IUPAC name is [1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-2-methylpropyl] cyclohexanecarboxylate.
| Compound Name | [1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-2-methylpropyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 90871071 |
| Molecular Formula | C16H23NO7 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | [1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-2-methylpropyl] cyclohexanecarboxylate |
| SMILES | CC(C)C(OC(=O)On1c(O)ccc1O)OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C16H23NO7/c1-10(2)15(22-14(20)11-6-4-3-5-7-11)23-16(21)24-17-12(18)8-9-13(17)19/h8-11,15,18-19H,3-7H2,1-2H3 |
| InChIKey | UCRFBAZBZTUFDB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|