C24H25N5O2 — CID 90873122
N-[3-[[5-acetyl-4-[[cyclopropyl(phenyl)methyl]amino]pyrimidin-2-yl]amino]phenyl]acetamide (PubChem CID 90873122) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is N-[3-[[5-acetyl-4-[[cyclopropyl(phenyl)methyl]amino]pyrimidin-2-yl]amino]phenyl]acetamide.
| Compound Name | N-[3-[[5-acetyl-4-[[cyclopropyl(phenyl)methyl]amino]pyrimidin-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 90873122 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | N-[3-[[5-acetyl-4-[[cyclopropyl(phenyl)methyl]amino]pyrimidin-2-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2ncc(C(C)=O)c(NC(c3ccccc3)C3CC3)n2)c1 |
| InChI | InChI=1S/C24H25N5O2/c1-15(30)21-14-25-24(27-20-10-6-9-19(13-20)26-16(2)31)29-23(21)28-22(18-11-12-18)17-7-4-3-5-8-17/h3-10,13-14,18,22H,11-12H2,1-2H3,(H,26,31)(H2,25,27,28,29) |
| InChIKey | VMBLRDGPGDOQQD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |