C24H21N4O5S+ — CID 90875094
N-cyclopropyl-1-[3-(1-hydroxy-6-methylsulfonylpyridin-1-ium-3-yl)phenyl]-4-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 90875094) has the molecular formula C24H21N4O5S+ and a molecular weight of 477.52 g/mol. Its IUPAC name is N-cyclopropyl-1-[3-(1-hydroxy-6-methylsulfonylpyridin-1-ium-3-yl)phenyl]-4-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-cyclopropyl-1-[3-(1-hydroxy-6-methylsulfonylpyridin-1-ium-3-yl)phenyl]-4-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 90875094 |
| Molecular Formula | C24H21N4O5S+ |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | N-cyclopropyl-1-[3-(1-hydroxy-6-methylsulfonylpyridin-1-ium-3-yl)phenyl]-4-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(-c2cccc(-n3cc(C(=O)NC4CC4)c(=O)c4cccnc43)c2)c[n+]1O |
| InChI | InChI=1S/C24H20N4O5S/c1-34(32,33)21-10-7-16(13-28(21)31)15-4-2-5-18(12-15)27-14-20(24(30)26-17-8-9-17)22(29)19-6-3-11-25-23(19)27/h2-7,10-14,17H,8-9H2,1H3,(H-,26,30,31)/p+1 |
| InChIKey | UZGXSKMFTSPHGM-UHFFFAOYSA-O |
| XLogP | 1.87 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|