C25H34FNO7 — CID 90877352
diethyl 3-oxopentanedioate;5-(4-fluorophenyl)-1-[(2S)-1-methylpyrrolidin-2-yl]pentane-1,3-dione (PubChem CID 90877352) has the molecular formula C25H34FNO7 and a molecular weight of 479.55 g/mol. Its IUPAC name is diethyl 3-oxopentanedioate;5-(4-fluorophenyl)-1-[(2S)-1-methylpyrrolidin-2-yl]pentane-1,3-dione.
| Compound Name | diethyl 3-oxopentanedioate;5-(4-fluorophenyl)-1-[(2S)-1-methylpyrrolidin-2-yl]pentane-1,3-dione |
|---|---|
| PubChem CID | 90877352 |
| Molecular Formula | C25H34FNO7 |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | diethyl 3-oxopentanedioate;5-(4-fluorophenyl)-1-[(2S)-1-methylpyrrolidin-2-yl]pentane-1,3-dione |
| SMILES | CCOC(=O)CC(=O)CC(=O)OCC.CN1CCC[C@H]1C(=O)CC(=O)CCc1ccc(F)cc1 |
| InChI | InChI=1S/C16H20FNO2.C9H14O5/c1-18-10-2-3-15(18)16(20)11-14(19)9-6-12-4-7-13(17)8-5-12;1-3-13-8(11)5-7(10)6-9(12)14-4-2/h4-5,7-8,15H,2-3,6,9-11H2,1H3;3-6H2,1-2H3/t15-;/m0./s1 |
| InChIKey | UNHMRXSLIMUOIZ-RSAXXLAASA-N |
| XLogP | 2.84 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|