C17H16F2O4S — CID 90877508
methyl 5-(2,4-difluorophenyl)-2-ethylsulfanylcarbonyloxycyclohexa-1,3-diene-1-carboxylate (PubChem CID 90877508) has the molecular formula C17H16F2O4S and a molecular weight of 354.37 g/mol. Its IUPAC name is methyl 5-(2,4-difluorophenyl)-2-ethylsulfanylcarbonyloxycyclohexa-1,3-diene-1-carboxylate.
| Compound Name | methyl 5-(2,4-difluorophenyl)-2-ethylsulfanylcarbonyloxycyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 90877508 |
| Molecular Formula | C17H16F2O4S |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | methyl 5-(2,4-difluorophenyl)-2-ethylsulfanylcarbonyloxycyclohexa-1,3-diene-1-carboxylate |
| SMILES | CCSC(=O)OC1=C(C(=O)OC)CC(c2ccc(F)cc2F)C=C1 |
| InChI | InChI=1S/C17H16F2O4S/c1-3-24-17(21)23-15-7-4-10(8-13(15)16(20)22-2)12-6-5-11(18)9-14(12)19/h4-7,9-10H,3,8H2,1-2H3 |
| InChIKey | MNBJFCLZCQGVDR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|