C22H18F3N5O6S2 — CID 90878282
4-hydroxy-1-[[2-(phenylsulfamoylamino)-4-pyridinyl]methyl]-3-[4-(trifluoromethylsulfonyl)phenyl]imidazol-2-one (PubChem CID 90878282) has the molecular formula C22H18F3N5O6S2 and a molecular weight of 569.54 g/mol. Its IUPAC name is 4-hydroxy-1-[[2-(phenylsulfamoylamino)-4-pyridinyl]methyl]-3-[4-(trifluoromethylsulfonyl)phenyl]imidazol-2-one.
| Compound Name | 4-hydroxy-1-[[2-(phenylsulfamoylamino)-4-pyridinyl]methyl]-3-[4-(trifluoromethylsulfonyl)phenyl]imidazol-2-one |
|---|---|
| PubChem CID | 90878282 |
| Molecular Formula | C22H18F3N5O6S2 |
| Molecular Weight | 569.54 g/mol |
| Exact Mass | 569.07 |
| IUPAC Name | 4-hydroxy-1-[[2-(phenylsulfamoylamino)-4-pyridinyl]methyl]-3-[4-(trifluoromethylsulfonyl)phenyl]imidazol-2-one |
| SMILES | O=c1n(Cc2ccnc(NS(=O)(=O)Nc3ccccc3)c2)cc(O)n1-c1ccc(S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H18F3N5O6S2/c23-22(24,25)37(33,34)18-8-6-17(7-9-18)30-20(31)14-29(21(30)32)13-15-10-11-26-19(12-15)28-38(35,36)27-16-4-2-1-3-5-16/h1-12,14,27,31H,13H2,(H,26,28) |
| InChIKey | JUOLTINISFFCJK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 152.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfonamide_E(2)', 'substructure': 'N/A'} |
|---|