C43H18F15N5 — CID 90878306
5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-24-(pyridin-2-ylmethyl)-7,21,22,23-tetrahydrocorrin (PubChem CID 90878306) has the molecular formula C43H18F15N5 and a molecular weight of 889.62 g/mol. Its IUPAC name is 5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-24-(pyridin-2-ylmethyl)-7,21,22,23-tetrahydrocorrin.
| Compound Name | 5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-24-(pyridin-2-ylmethyl)-7,21,22,23-tetrahydrocorrin |
|---|---|
| PubChem CID | 90878306 |
| Molecular Formula | C43H18F15N5 |
| Molecular Weight | 889.62 g/mol |
| Exact Mass | 889.13 |
| IUPAC Name | 5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-24-(pyridin-2-ylmethyl)-7,21,22,23-tetrahydrocorrin |
| SMILES | Fc1c(F)c(F)c(C2=C3CC=C(N3)C(c3c(F)c(F)c(F)c(F)c3F)=c3ccc([nH]3)=C(c3c(F)c(F)c(F)c(F)c3F)c3ccc(n3Cc3ccccn3)-c3ccc2[nH]3)c(F)c1F |
| InChI | InChI=1S/C43H18F15N5/c44-29-26(30(45)36(51)41(56)35(29)50)23-16-5-4-15(60-16)21-10-11-22(63(21)13-14-3-1-2-12-59-14)25(28-33(48)39(54)43(58)40(55)34(28)49)20-9-8-19(62-20)24(18-7-6-17(23)61-18)27-31(46)37(52)42(57)38(53)32(27)47/h1-5,7-12,60-62H,6,13H2 |
| InChIKey | VDFZGYBYAZLQED-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 61.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.62 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|