C32H34ClFN3O3- — CID 90880046
(4-fluorocyclohexa-1,3-dien-1-yl) 6-chloro-1-[3-(3-piperidin-4-id-1-ylpropoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 90880046) has the molecular formula C32H34ClFN3O3- and a molecular weight of 563.09 g/mol. Its IUPAC name is (4-fluorocyclohexa-1,3-dien-1-yl) 6-chloro-1-[3-(3-piperidin-4-id-1-ylpropoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-fluorocyclohexa-1,3-dien-1-yl) 6-chloro-1-[3-(3-piperidin-4-id-1-ylpropoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 90880046 |
| Molecular Formula | C32H34ClFN3O3- |
| Molecular Weight | 563.09 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | (4-fluorocyclohexa-1,3-dien-1-yl) 6-chloro-1-[3-(3-piperidin-4-id-1-ylpropoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | O=C(OC1=CC=C(F)CC1)N1CCc2c([nH]c3ccc(Cl)cc23)C1c1cccc(OCCCN2CC[CH-]CC2)c1 |
| InChI | InChI=1S/C32H34ClFN3O3/c33-23-8-13-29-28(21-23)27-14-18-37(32(38)40-25-11-9-24(34)10-12-25)31(30(27)35-29)22-6-4-7-26(20-22)39-19-5-17-36-15-2-1-3-16-36/h1,4,6-9,11,13,20-21,31,35H,2-3,5,10,12,14-19H2/q-1 |
| InChIKey | KUOMVXFXHMZZDO-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.09 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|