About 1-[2,5-bis(but-1-en-2-yl)-4-(2-hydroxypropoxy)phenoxy]propan-2-ol
1-[2,5-bis(but-1-en-2-yl)-4-(2-hydroxypropoxy)phenoxy]propan-2-ol (PubChem CID 90880604) has the molecular formula C20H30O4
and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-[2,5-bis(but-1-en-2-yl)-4-(2-hydroxypropoxy)phenoxy]propan-2-ol.
Molecular Properties
| Compound Name | 1-[2,5-bis(but-1-en-2-yl)-4-(2-hydroxypropoxy)phenoxy]propan-2-ol |
| PubChem CID | 90880604 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 1-[2,5-bis(but-1-en-2-yl)-4-(2-hydroxypropoxy)phenoxy]propan-2-ol |
| SMILES | C=C(CC)c1cc(OCC(C)O)c(C(=C)CC)cc1OCC(C)O |
| InChI | InChI=1S/C20H30O4/c1-7-13(3)17-9-20(24-12-16(6)22)18(14(4)8-2)10-19(17)23-11-15(5)21/h9-10,15-16,21-22H,3-4,7-8,11-12H2,1-2,5-6H3 |
| InChIKey | GGQJIAPQBZJRDI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2,5-bis(but-1-en-2-yl)-4-(2-hydroxypropoxy)phenoxy]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,5-bis(but-1-en-2-yl)-4-(2-hydroxypropoxy)phenoxy]propan-2-ol?
The IUPAC name of 1-[2,5-bis(but-1-en-2-yl)-4-(2-hydroxypropoxy)phenoxy]propan-2-ol (CID 90880604) is 1-[2,5-bis(but-1-en-2-yl)-4-(2-hydroxypropoxy)phenoxy]propan-2-ol.
What is the SMILES notation for 1-[2,5-bis(but-1-en-2-yl)-4-(2-hydroxypropoxy)phenoxy]propan-2-ol?
The canonical SMILES for 1-[2,5-bis(but-1-en-2-yl)-4-(2-hydroxypropoxy)phenoxy]propan-2-ol is C=C(CC)c1cc(OCC(C)O)c(C(=C)CC)cc1OCC(C)O.
What is the InChIKey of 1-[2,5-bis(but-1-en-2-yl)-4-(2-hydroxypropoxy)phenoxy]propan-2-ol?
The InChIKey is GGQJIAPQBZJRDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30O4/c1-7-13(3)17-9-20(24-12-16(6)22)18(14(4)8-2)10-19(17)23-11-15(5)21/h9-10,15-16,21-22H,3-4,7-8,11-12H2,1-2,5-6H3.
What are the key properties of 1-[2,5-bis(but-1-en-2-yl)-4-(2-hydroxypropoxy)phenoxy]propan-2-ol?
1-[2,5-bis(but-1-en-2-yl)-4-(2-hydroxypropoxy)phenoxy]propan-2-ol has a molecular weight of 334.46 g/mol, XLogP of 4.05, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,5-bis(but-1-en-2-yl)-4-(2-hydroxypropoxy)phenoxy]propan-2-ol is sourced from PubChem (CID 90880604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).