C17H14ClNO4 — CID 90880841
3-[2-[4-(4-chlorophenoxy)phenyl]ethyl]-4-hydroxy-1,3-oxazol-2-one (PubChem CID 90880841) has the molecular formula C17H14ClNO4 and a molecular weight of 331.76 g/mol. Its IUPAC name is 3-[2-[4-(4-chlorophenoxy)phenyl]ethyl]-4-hydroxy-1,3-oxazol-2-one.
| Compound Name | 3-[2-[4-(4-chlorophenoxy)phenyl]ethyl]-4-hydroxy-1,3-oxazol-2-one |
|---|---|
| PubChem CID | 90880841 |
| Molecular Formula | C17H14ClNO4 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 3-[2-[4-(4-chlorophenoxy)phenyl]ethyl]-4-hydroxy-1,3-oxazol-2-one |
| SMILES | O=c1occ(O)n1CCc1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H14ClNO4/c18-13-3-7-15(8-4-13)23-14-5-1-12(2-6-14)9-10-19-16(20)11-22-17(19)21/h1-8,11,20H,9-10H2 |
| InChIKey | GZYGXXQGJSWIJC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |