C21H14F3N3O — CID 90881543
isoquinolin-5-yl-[5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]methanone (PubChem CID 90881543) has the molecular formula C21H14F3N3O and a molecular weight of 381.36 g/mol. Its IUPAC name is isoquinolin-5-yl-[5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]methanone.
| Compound Name | isoquinolin-5-yl-[5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 90881543 |
| Molecular Formula | C21H14F3N3O |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | isoquinolin-5-yl-[5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]methanone |
| SMILES | Cc1cc(C(=O)c2cccc3cnccc23)nn1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H14F3N3O/c1-13-10-19(20(28)18-7-2-4-14-12-25-9-8-17(14)18)26-27(13)16-6-3-5-15(11-16)21(22,23)24/h2-12H,1H3 |
| InChIKey | QBBDLZIQIOVNDP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |