C20H20ClN3O4 — CID 9088245
[(3S)-6-chloro-3,4-dihydro-2H-chromen-3-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 9088245) has the molecular formula C20H20ClN3O4 and a molecular weight of 401.85 g/mol. Its IUPAC name is [(3S)-6-chloro-3,4-dihydro-2H-chromen-3-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [(3S)-6-chloro-3,4-dihydro-2H-chromen-3-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 9088245 |
| Molecular Formula | C20H20ClN3O4 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | [(3S)-6-chloro-3,4-dihydro-2H-chromen-3-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | O=C([C@@H]1COc2ccc(Cl)cc2C1)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C20H20ClN3O4/c21-16-1-6-19-14(12-16)11-15(13-28-19)20(25)23-9-7-22(8-10-23)17-2-4-18(5-3-17)24(26)27/h1-6,12,15H,7-11,13H2/t15-/m0/s1 |
| InChIKey | JPKHXHYFRRUKGE-HNNXBMFYSA-N |
| XLogP | 3.15 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|