C23H29N4O3+ — CID 90882454
methylidene-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-[4-(pyrrolidine-2-carbonylamino)phenyl]azanium (PubChem CID 90882454) has the molecular formula C23H29N4O3+ and a molecular weight of 409.51 g/mol. Its IUPAC name is methylidene-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-[4-(pyrrolidine-2-carbonylamino)phenyl]azanium.
| Compound Name | methylidene-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-[4-(pyrrolidine-2-carbonylamino)phenyl]azanium |
|---|---|
| PubChem CID | 90882454 |
| Molecular Formula | C23H29N4O3+ |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | methylidene-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-[4-(pyrrolidine-2-carbonylamino)phenyl]azanium |
| SMILES | C=[N+](c1ccc(NC(=O)OC(C)(C)C)cc1)c1ccc(NC(=O)C2CCCN2)cc1 |
| InChI | InChI=1S/C23H28N4O3/c1-23(2,3)30-22(29)26-17-9-13-19(14-10-17)27(4)18-11-7-16(8-12-18)25-21(28)20-6-5-15-24-20/h7-14,20,24H,4-6,15H2,1-3H3,(H-,25,26,28,29)/p+1 |
| InChIKey | AEENHWQTQQEBGT-UHFFFAOYSA-O |
| XLogP | 4.26 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|