C34H37FNO6P — CID 90883047
(4R,6S)-6-[2-[2-cyclopropyl-4-[2-(5-diethoxyphosphorylpent-1-ynyl)-4-fluorophenyl]quinolin-3-yl]ethenyl]-4-hydroxyoxan-2-one (PubChem CID 90883047) has the molecular formula C34H37FNO6P and a molecular weight of 605.64 g/mol. Its IUPAC name is (4R,6S)-6-[2-[2-cyclopropyl-4-[2-(5-diethoxyphosphorylpent-1-ynyl)-4-fluorophenyl]quinolin-3-yl]ethenyl]-4-hydroxyoxan-2-one.
| Compound Name | (4R,6S)-6-[2-[2-cyclopropyl-4-[2-(5-diethoxyphosphorylpent-1-ynyl)-4-fluorophenyl]quinolin-3-yl]ethenyl]-4-hydroxyoxan-2-one |
|---|---|
| PubChem CID | 90883047 |
| Molecular Formula | C34H37FNO6P |
| Molecular Weight | 605.64 g/mol |
| Exact Mass | 605.23 |
| IUPAC Name | (4R,6S)-6-[2-[2-cyclopropyl-4-[2-(5-diethoxyphosphorylpent-1-ynyl)-4-fluorophenyl]quinolin-3-yl]ethenyl]-4-hydroxyoxan-2-one |
| SMILES | CCOP(=O)(CCCC#Cc1cc(F)ccc1-c1c(C=C[C@@H]2C[C@@H](O)CC(=O)O2)c(C2CC2)nc2ccccc12)OCC |
| InChI | InChI=1S/C34H37FNO6P/c1-3-40-43(39,41-4-2)19-9-5-6-10-24-20-25(35)15-17-28(24)33-29-11-7-8-12-31(29)36-34(23-13-14-23)30(33)18-16-27-21-26(37)22-32(38)42-27/h7-8,11-12,15-18,20,23,26-27,37H,3-5,9,13-14,19,21-22H2,1-2H3/t26-,27-/m1/s1 |
| InChIKey | JXRLMNJGDAZYIJ-KAYWLYCHSA-N |
| XLogP | 7.40 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.64 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|