C26H46N2O3 — CID 90884692
1-[2-(2-pentyl-1,3-oxazolidin-3-yl)ethyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrole-2,5-diol (PubChem CID 90884692) has the molecular formula C26H46N2O3 and a molecular weight of 434.67 g/mol. Its IUPAC name is 1-[2-(2-pentyl-1,3-oxazolidin-3-yl)ethyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrole-2,5-diol.
| Compound Name | 1-[2-(2-pentyl-1,3-oxazolidin-3-yl)ethyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 90884692 |
| Molecular Formula | C26H46N2O3 |
| Molecular Weight | 434.67 g/mol |
| Exact Mass | 434.35 |
| IUPAC Name | 1-[2-(2-pentyl-1,3-oxazolidin-3-yl)ethyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrole-2,5-diol |
| SMILES | C=C(Cc1cc(O)n(CCN2CCOC2CCCCC)c1O)CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C26H46N2O3/c1-8-9-10-11-23-27(14-15-31-23)12-13-28-22(29)17-21(24(28)30)16-20(2)18-26(6,7)19-25(3,4)5/h17,23,29-30H,2,8-16,18-19H2,1,3-7H3 |
| InChIKey | HKKKDKGPLFCYCI-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 57.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.67 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|