C27H30N2O4 — CID 90885461
benzyl (2S)-2-[[2-hydroxyethyl-[2-(4-phenylphenyl)ethyl]carbamoyl]amino]propanoate (PubChem CID 90885461) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is benzyl (2S)-2-[[2-hydroxyethyl-[2-(4-phenylphenyl)ethyl]carbamoyl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[2-hydroxyethyl-[2-(4-phenylphenyl)ethyl]carbamoyl]amino]propanoate |
|---|---|
| PubChem CID | 90885461 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | benzyl (2S)-2-[[2-hydroxyethyl-[2-(4-phenylphenyl)ethyl]carbamoyl]amino]propanoate |
| SMILES | C[C@H](NC(=O)N(CCO)CCc1ccc(-c2ccccc2)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H30N2O4/c1-21(26(31)33-20-23-8-4-2-5-9-23)28-27(32)29(18-19-30)17-16-22-12-14-25(15-13-22)24-10-6-3-7-11-24/h2-15,21,30H,16-20H2,1H3,(H,28,32)/t21-/m0/s1 |
| InChIKey | YQEKGEUVPCCYRE-NRFANRHFSA-N |
| XLogP | 4.03 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |