C22H30N2O2 — CID 86943757
1-(2-hydroxyethyl)-3-(3-methyl-2-phenylbutyl)-1-(2-phenylethyl)urea (PubChem CID 86943757) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-(3-methyl-2-phenylbutyl)-1-(2-phenylethyl)urea.
| Compound Name | 1-(2-hydroxyethyl)-3-(3-methyl-2-phenylbutyl)-1-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 86943757 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-(3-methyl-2-phenylbutyl)-1-(2-phenylethyl)urea |
| SMILES | CC(C)C(CNC(=O)N(CCO)CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H30N2O2/c1-18(2)21(20-11-7-4-8-12-20)17-23-22(26)24(15-16-25)14-13-19-9-5-3-6-10-19/h3-12,18,21,25H,13-17H2,1-2H3,(H,23,26) |
| InChIKey | CQSYLBCECSZYGJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |