C23H30ClN3O3 — CID 86943814
3-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-1-(2-hydroxyethyl)-1-(2-phenylethyl)urea (PubChem CID 86943814) has the molecular formula C23H30ClN3O3 and a molecular weight of 431.96 g/mol. Its IUPAC name is 3-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-1-(2-hydroxyethyl)-1-(2-phenylethyl)urea.
| Compound Name | 3-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-1-(2-hydroxyethyl)-1-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 86943814 |
| Molecular Formula | C23H30ClN3O3 |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 3-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-1-(2-hydroxyethyl)-1-(2-phenylethyl)urea |
| SMILES | O=C(NCC(c1cccc(Cl)c1)N1CCOCC1)N(CCO)CCc1ccccc1 |
| InChI | InChI=1S/C23H30ClN3O3/c24-21-8-4-7-20(17-21)22(26-12-15-30-16-13-26)18-25-23(29)27(11-14-28)10-9-19-5-2-1-3-6-19/h1-8,17,22,28H,9-16,18H2,(H,25,29) |
| InChIKey | VFGXMTSHWTUPPS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |