C13H14FN3O4S — CID 9088553
N'-[2-(4-fluorophenoxy)acetyl]-2-(2-oxo-1,3-thiazolidin-3-yl)acetohydrazide (PubChem CID 9088553) has the molecular formula C13H14FN3O4S and a molecular weight of 327.34 g/mol. Its IUPAC name is N'-[2-(4-fluorophenoxy)acetyl]-2-(2-oxo-1,3-thiazolidin-3-yl)acetohydrazide.
| Compound Name | N'-[2-(4-fluorophenoxy)acetyl]-2-(2-oxo-1,3-thiazolidin-3-yl)acetohydrazide |
|---|---|
| PubChem CID | 9088553 |
| Molecular Formula | C13H14FN3O4S |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | N'-[2-(4-fluorophenoxy)acetyl]-2-(2-oxo-1,3-thiazolidin-3-yl)acetohydrazide |
| SMILES | O=C(COc1ccc(F)cc1)NNC(=O)CN1CCSC1=O |
| InChI | InChI=1S/C13H14FN3O4S/c14-9-1-3-10(4-2-9)21-8-12(19)16-15-11(18)7-17-5-6-22-13(17)20/h1-4H,5-8H2,(H,15,18)(H,16,19) |
| InChIKey | MUUJDBWKBAJQRT-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|