C12H23- — CID 90886074
1,1,2-trimethyl-3-(2-methylbutan-2-yl)cyclobutane (PubChem CID 90886074) has the molecular formula C12H23- and a molecular weight of 167.32 g/mol. Its IUPAC name is 1,1,2-trimethyl-3-(2-methylbutan-2-yl)cyclobutane.
| Compound Name | 1,1,2-trimethyl-3-(2-methylbutan-2-yl)cyclobutane |
|---|---|
| PubChem CID | 90886074 |
| Molecular Formula | C12H23- |
| Molecular Weight | 167.32 g/mol |
| Exact Mass | 167.18 |
| IUPAC Name | 1,1,2-trimethyl-3-(2-methylbutan-2-yl)cyclobutane |
| SMILES | CCC(C)(C)[C-]1CC(C)(C)C1C |
| InChI | InChI=1S/C12H23/c1-7-11(3,4)10-8-12(5,6)9(10)2/h9H,7-8H2,1-6H3/q-1 |
| InChIKey | ZKISRISAMBQMKR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|