C22H45ClN2 — CID 90886504
1-N,1-N,2-N,2-N-tetrabutyl-1-chlorocyclohexane-1,2-diamine (PubChem CID 90886504) has the molecular formula C22H45ClN2 and a molecular weight of 373.07 g/mol. Its IUPAC name is 1-N,1-N,2-N,2-N-tetrabutyl-1-chlorocyclohexane-1,2-diamine.
| Compound Name | 1-N,1-N,2-N,2-N-tetrabutyl-1-chlorocyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 90886504 |
| Molecular Formula | C22H45ClN2 |
| Molecular Weight | 373.07 g/mol |
| Exact Mass | 372.33 |
| IUPAC Name | 1-N,1-N,2-N,2-N-tetrabutyl-1-chlorocyclohexane-1,2-diamine |
| SMILES | CCCCN(CCCC)C1CCCCC1(Cl)N(CCCC)CCCC |
| InChI | InChI=1S/C22H45ClN2/c1-5-9-17-24(18-10-6-2)21-15-13-14-16-22(21,23)25(19-11-7-3)20-12-8-4/h21H,5-20H2,1-4H3 |
| InChIKey | LNVLBNWHPCSATG-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.07 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|