C23H48Cl2N2O3 — CID 140974005
[2,2-bis(dibutylamino)cyclohexyl] hydrogen carbonate;dihydrochloride (PubChem CID 140974005) has the molecular formula C23H48Cl2N2O3 and a molecular weight of 471.55 g/mol. Its IUPAC name is [2,2-bis(dibutylamino)cyclohexyl] hydrogen carbonate;dihydrochloride.
| Compound Name | [2,2-bis(dibutylamino)cyclohexyl] hydrogen carbonate;dihydrochloride |
|---|---|
| PubChem CID | 140974005 |
| Molecular Formula | C23H48Cl2N2O3 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | [2,2-bis(dibutylamino)cyclohexyl] hydrogen carbonate;dihydrochloride |
| SMILES | CCCCN(CCCC)C1(N(CCCC)CCCC)CCCCC1OC(=O)O.Cl.Cl |
| InChI | InChI=1S/C23H46N2O3.2ClH/c1-5-9-17-24(18-10-6-2)23(25(19-11-7-3)20-12-8-4)16-14-13-15-21(23)28-22(26)27;;/h21H,5-20H2,1-4H3,(H,26,27);2*1H |
| InChIKey | VASWPKWLGIGDEU-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|