C23H41NO4 — CID 90306953
(1-ethylcyclopentyl) N-cyclopentyloxycarbonyl-N-nonylcarbamate (PubChem CID 90306953) has the molecular formula C23H41NO4 and a molecular weight of 395.58 g/mol. Its IUPAC name is (1-ethylcyclopentyl) N-cyclopentyloxycarbonyl-N-nonylcarbamate.
| Compound Name | (1-ethylcyclopentyl) N-cyclopentyloxycarbonyl-N-nonylcarbamate |
|---|---|
| PubChem CID | 90306953 |
| Molecular Formula | C23H41NO4 |
| Molecular Weight | 395.58 g/mol |
| Exact Mass | 395.30 |
| IUPAC Name | (1-ethylcyclopentyl) N-cyclopentyloxycarbonyl-N-nonylcarbamate |
| SMILES | CCCCCCCCCN(C(=O)OC1CCCC1)C(=O)OC1(CC)CCCC1 |
| InChI | InChI=1S/C23H41NO4/c1-3-5-6-7-8-9-14-19-24(21(25)27-20-15-10-11-16-20)22(26)28-23(4-2)17-12-13-18-23/h20H,3-19H2,1-2H3 |
| InChIKey | PQXORBIFKJHXPR-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.58 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|