About (1-ethylcyclopentyl) pentanoate
(1-ethylcyclopentyl) pentanoate (PubChem CID 123172403) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is (1-ethylcyclopentyl) pentanoate.
Molecular Properties
| Compound Name | (1-ethylcyclopentyl) pentanoate |
| PubChem CID | 123172403 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (1-ethylcyclopentyl) pentanoate |
| SMILES | CCCCC(=O)OC1(CC)CCCC1 |
| InChI | InChI=1S/C12H22O2/c1-3-5-8-11(13)14-12(4-2)9-6-7-10-12/h3-10H2,1-2H3 |
| InChIKey | MKNHANXFHMIXKP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-ethylcyclopentyl) pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylcyclopentyl) pentanoate?
The IUPAC name of (1-ethylcyclopentyl) pentanoate (CID 123172403) is (1-ethylcyclopentyl) pentanoate.
What is the SMILES notation for (1-ethylcyclopentyl) pentanoate?
The canonical SMILES for (1-ethylcyclopentyl) pentanoate is CCCCC(=O)OC1(CC)CCCC1.
What is the InChIKey of (1-ethylcyclopentyl) pentanoate?
The InChIKey is MKNHANXFHMIXKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-3-5-8-11(13)14-12(4-2)9-6-7-10-12/h3-10H2,1-2H3.
What are the key properties of (1-ethylcyclopentyl) pentanoate?
(1-ethylcyclopentyl) pentanoate has a molecular weight of 198.31 g/mol, XLogP of 3.44, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylcyclopentyl) pentanoate is sourced from PubChem (CID 123172403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).