C9H14N2 — CID 90886674
N-[(3Z)-3-[(methylideneamino)methyl]penta-1,3-dien-2-yl]ethanimine (PubChem CID 90886674) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is N-[(3Z)-3-[(methylideneamino)methyl]penta-1,3-dien-2-yl]ethanimine.
| Compound Name | N-[(3Z)-3-[(methylideneamino)methyl]penta-1,3-dien-2-yl]ethanimine |
|---|---|
| PubChem CID | 90886674 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | N-[(3Z)-3-[(methylideneamino)methyl]penta-1,3-dien-2-yl]ethanimine |
| SMILES | C=NC/C(=C/C)C(=C)/N=C/C |
| InChI | InChI=1S/C9H14N2/c1-5-9(7-10-4)8(3)11-6-2/h5-6H,3-4,7H2,1-2H3/b9-5-,11-6+ |
| InChIKey | BGEDWYBMTFVVSP-YCQMDOFOSA-N |
| XLogP | 2.24 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|