C21H22N2O4S — CID 9088688
N'-[(2R)-2-(4-ethoxyphenoxy)propanoyl]-3-methyl-1-benzothiophene-2-carbohydrazide (PubChem CID 9088688) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is N'-[(2R)-2-(4-ethoxyphenoxy)propanoyl]-3-methyl-1-benzothiophene-2-carbohydrazide.
| Compound Name | N'-[(2R)-2-(4-ethoxyphenoxy)propanoyl]-3-methyl-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 9088688 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N'-[(2R)-2-(4-ethoxyphenoxy)propanoyl]-3-methyl-1-benzothiophene-2-carbohydrazide |
| SMILES | CCOc1ccc(O[C@H](C)C(=O)NNC(=O)c2sc3ccccc3c2C)cc1 |
| InChI | InChI=1S/C21H22N2O4S/c1-4-26-15-9-11-16(12-10-15)27-14(3)20(24)22-23-21(25)19-13(2)17-7-5-6-8-18(17)28-19/h5-12,14H,4H2,1-3H3,(H,22,24)(H,23,25)/t14-/m1/s1 |
| InChIKey | HPLQATSTFBXKKH-CQSZACIVSA-N |
| XLogP | 3.84 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|