C31H62N2 — CID 90886997
N-butyl-3-methyl-N-propylpent-1-en-2-amine;(E)-N-(3,4-dimethylhex-1-en-2-yl)-N-ethyloct-3-en-1-amine (PubChem CID 90886997) has the molecular formula C31H62N2 and a molecular weight of 462.85 g/mol. Its IUPAC name is N-butyl-3-methyl-N-propylpent-1-en-2-amine;(E)-N-(3,4-dimethylhex-1-en-2-yl)-N-ethyloct-3-en-1-amine.
| Compound Name | N-butyl-3-methyl-N-propylpent-1-en-2-amine;(E)-N-(3,4-dimethylhex-1-en-2-yl)-N-ethyloct-3-en-1-amine |
|---|---|
| PubChem CID | 90886997 |
| Molecular Formula | C31H62N2 |
| Molecular Weight | 462.85 g/mol |
| Exact Mass | 462.49 |
| IUPAC Name | N-butyl-3-methyl-N-propylpent-1-en-2-amine;(E)-N-(3,4-dimethylhex-1-en-2-yl)-N-ethyloct-3-en-1-amine |
| SMILES | C=C(C(C)C(C)CC)N(CC)CC/C=C/CCCC.C=C(C(C)CC)N(CCC)CCCC |
| InChI | InChI=1S/C18H35N.C13H27N/c1-7-10-11-12-13-14-15-19(9-3)18(6)17(5)16(4)8-2;1-6-9-11-14(10-7-2)13(5)12(4)8-3/h12-13,16-17H,6-11,14-15H2,1-5H3;12H,5-11H2,1-4H3/b13-12+; |
| InChIKey | NXIJSLROPFQEAB-UEIGIMKUSA-N |
| XLogP | 9.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.85 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|