C22H26Cl2N2O — CID 90889755
N-[(2,6-dichlorophenyl)methoxy]-1-[1-(3-phenylpropyl)piperidin-4-ylidene]methanamine (PubChem CID 90889755) has the molecular formula C22H26Cl2N2O and a molecular weight of 405.37 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methoxy]-1-[1-(3-phenylpropyl)piperidin-4-ylidene]methanamine.
| Compound Name | N-[(2,6-dichlorophenyl)methoxy]-1-[1-(3-phenylpropyl)piperidin-4-ylidene]methanamine |
|---|---|
| PubChem CID | 90889755 |
| Molecular Formula | C22H26Cl2N2O |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methoxy]-1-[1-(3-phenylpropyl)piperidin-4-ylidene]methanamine |
| SMILES | Clc1cccc(Cl)c1CONC=C1CCN(CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H26Cl2N2O/c23-21-9-4-10-22(24)20(21)17-27-25-16-19-11-14-26(15-12-19)13-5-8-18-6-2-1-3-7-18/h1-4,6-7,9-10,16,25H,5,8,11-15,17H2 |
| InChIKey | WUQPKUNBKJYFHL-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|