C22H27Cl3N2O — CID 24774610
(E)-N-[(2,6-dichlorophenyl)methoxy]-1-[1-(3-phenylpropyl)piperidin-4-yl]methanimine;hydrochloride (PubChem CID 24774610) has the molecular formula C22H27Cl3N2O and a molecular weight of 441.83 g/mol. Its IUPAC name is (E)-N-[(2,6-dichlorophenyl)methoxy]-1-[1-(3-phenylpropyl)piperidin-4-yl]methanimine;hydrochloride.
| Compound Name | (E)-N-[(2,6-dichlorophenyl)methoxy]-1-[1-(3-phenylpropyl)piperidin-4-yl]methanimine;hydrochloride |
|---|---|
| PubChem CID | 24774610 |
| Molecular Formula | C22H27Cl3N2O |
| Molecular Weight | 441.83 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | (E)-N-[(2,6-dichlorophenyl)methoxy]-1-[1-(3-phenylpropyl)piperidin-4-yl]methanimine;hydrochloride |
| SMILES | Cl.Clc1cccc(Cl)c1CO/N=C/C1CCN(CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H26Cl2N2O.ClH/c23-21-9-4-10-22(24)20(21)17-27-25-16-19-11-14-26(15-12-19)13-5-8-18-6-2-1-3-7-18;/h1-4,6-7,9-10,16,19H,5,8,11-15,17H2;1H/b25-16+; |
| InChIKey | XHKIHTPQZDMNDB-SRTPWMEPSA-N |
| XLogP | 6.26 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.83 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|