C19H29NO6 — CID 90891448
[(2S,3R)-3-[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]oxybutan-2-yl] 3,3-dimethylbutanoate (PubChem CID 90891448) has the molecular formula C19H29NO6 and a molecular weight of 367.44 g/mol. Its IUPAC name is [(2S,3R)-3-[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]oxybutan-2-yl] 3,3-dimethylbutanoate.
| Compound Name | [(2S,3R)-3-[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]oxybutan-2-yl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 90891448 |
| Molecular Formula | C19H29NO6 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | [(2S,3R)-3-[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]oxybutan-2-yl] 3,3-dimethylbutanoate |
| SMILES | C[C@H](OC(=O)CC(C)(C)C)[C@@H](C)OC(=O)[C@@H](N)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H29NO6/c1-11(25-17(23)10-19(3,4)5)12(2)26-18(24)14(20)8-13-6-7-15(21)16(22)9-13/h6-7,9,11-12,14,21-22H,8,10,20H2,1-5H3/t11-,12+,14-/m0/s1 |
| InChIKey | WNSRMMDGMNKRPV-SCRDCRAPSA-N |
| XLogP | 2.27 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|