C9H9F2NO — CID 90892252
3,4-bis(fluoromethyl)benzamide (PubChem CID 90892252) has the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. Its IUPAC name is 3,4-bis(fluoromethyl)benzamide.
| Compound Name | 3,4-bis(fluoromethyl)benzamide |
|---|---|
| PubChem CID | 90892252 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 3,4-bis(fluoromethyl)benzamide |
| SMILES | NC(=O)c1ccc(CF)c(CF)c1 |
| InChI | InChI=1S/C9H9F2NO/c10-4-7-2-1-6(9(12)13)3-8(7)5-11/h1-3H,4-5H2,(H2,12,13) |
| InChIKey | NSAYCSRWVGEVKH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |