C34H54O3 — CID 90892733
(6S,8R,11S)-8-methyl-11-propan-2-yl-2-(4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl)-1,5-dioxaspiro[5.5]undec-2-en-4-one (PubChem CID 90892733) has the molecular formula C34H54O3 and a molecular weight of 510.80 g/mol. Its IUPAC name is (6S,8R,11S)-8-methyl-11-propan-2-yl-2-(4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl)-1,5-dioxaspiro[5.5]undec-2-en-4-one.
| Compound Name | (6S,8R,11S)-8-methyl-11-propan-2-yl-2-(4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl)-1,5-dioxaspiro[5.5]undec-2-en-4-one |
|---|---|
| PubChem CID | 90892733 |
| Molecular Formula | C34H54O3 |
| Molecular Weight | 510.80 g/mol |
| Exact Mass | 510.41 |
| IUPAC Name | (6S,8R,11S)-8-methyl-11-propan-2-yl-2-(4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl)-1,5-dioxaspiro[5.5]undec-2-en-4-one |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC1=CC(=O)O[C@]2(C[C@H](C)CC[C@H]2C(C)C)O1 |
| InChI | InChI=1S/C34H54O3/c1-25(2)13-9-14-27(5)15-10-16-28(6)17-11-18-29(7)19-12-20-31-23-33(35)37-34(36-31)24-30(8)21-22-32(34)26(3)4/h13,15,17,19,23,26,30,32H,9-12,14,16,18,20-22,24H2,1-8H3/t30-,32+,34+/m1/s1 |
| InChIKey | NYLVQMCFOXKMKY-LLISZCHOSA-N |
| XLogP | 10.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.80 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|