C20H30O3 — CID 579036
2-but-3-enyl-8-methyl-11-propan-2-yl-3-prop-2-enyl-1,5-dioxaspiro[5.5]undec-2-en-4-one (PubChem CID 579036) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is 2-but-3-enyl-8-methyl-11-propan-2-yl-3-prop-2-enyl-1,5-dioxaspiro[5.5]undec-2-en-4-one.
| Compound Name | 2-but-3-enyl-8-methyl-11-propan-2-yl-3-prop-2-enyl-1,5-dioxaspiro[5.5]undec-2-en-4-one |
|---|---|
| PubChem CID | 579036 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 2-but-3-enyl-8-methyl-11-propan-2-yl-3-prop-2-enyl-1,5-dioxaspiro[5.5]undec-2-en-4-one |
| SMILES | C=CCCC1=C(CC=C)C(=O)OC2(CC(C)CCC2C(C)C)O1 |
| InChI | InChI=1S/C20H30O3/c1-6-8-10-18-16(9-7-2)19(21)23-20(22-18)13-15(5)11-12-17(20)14(3)4/h6-7,14-15,17H,1-2,8-13H2,3-5H3 |
| InChIKey | NBAMIUJRXOIVOP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|