C20H17N5O — CID 90893582
3-(furan-2-yl)prop-2-enyl-(3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-yl)diazene (PubChem CID 90893582) has the molecular formula C20H17N5O and a molecular weight of 343.39 g/mol. Its IUPAC name is 3-(furan-2-yl)prop-2-enyl-(3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-yl)diazene.
| Compound Name | 3-(furan-2-yl)prop-2-enyl-(3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-yl)diazene |
|---|---|
| PubChem CID | 90893582 |
| Molecular Formula | C20H17N5O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 3-(furan-2-yl)prop-2-enyl-(3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-yl)diazene |
| SMILES | Cc1nn(-c2ccccc2)c2nccc(/N=N/CC=Cc3ccco3)c12 |
| InChI | InChI=1S/C20H17N5O/c1-15-19-18(23-22-12-5-9-17-10-6-14-26-17)11-13-21-20(19)25(24-15)16-7-3-2-4-8-16/h2-11,13-14H,12H2,1H3/b9-5?,23-22+ |
| InChIKey | PJKKHGZFYWPQIP-HXMNSRKYSA-N |
| XLogP | 5.12 |
| TPSA | 68.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|