C20H26ClN3OS — CID 90894710
3-(4-chlorophenyl)-N-cyclohexyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide (PubChem CID 90894710) has the molecular formula C20H26ClN3OS and a molecular weight of 391.97 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-cyclohexyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide.
| Compound Name | 3-(4-chlorophenyl)-N-cyclohexyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide |
|---|---|
| PubChem CID | 90894710 |
| Molecular Formula | C20H26ClN3OS |
| Molecular Weight | 391.97 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 3-(4-chlorophenyl)-N-cyclohexyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide |
| SMILES | S=C(NC1CCCCC1)N1CCC2(C=C(c3ccc(Cl)cc3)NO2)CC1 |
| InChI | InChI=1S/C20H26ClN3OS/c21-16-8-6-15(7-9-16)18-14-20(25-23-18)10-12-24(13-11-20)19(26)22-17-4-2-1-3-5-17/h6-9,14,17,23H,1-5,10-13H2,(H,22,26) |
| InChIKey | HPGMUASUWANLDX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.97 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|