C26H34N2O3 — CID 90895678
4-[2-(1-tert-butylpiperidin-4-yl)-4H-1,3-benzodioxin-6-yl]-N-ethylbenzamide (PubChem CID 90895678) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is 4-[2-(1-tert-butylpiperidin-4-yl)-4H-1,3-benzodioxin-6-yl]-N-ethylbenzamide.
| Compound Name | 4-[2-(1-tert-butylpiperidin-4-yl)-4H-1,3-benzodioxin-6-yl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 90895678 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 4-[2-(1-tert-butylpiperidin-4-yl)-4H-1,3-benzodioxin-6-yl]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(-c2ccc3c(c2)COC(C2CCN(C(C)(C)C)CC2)O3)cc1 |
| InChI | InChI=1S/C26H34N2O3/c1-5-27-24(29)19-8-6-18(7-9-19)21-10-11-23-22(16-21)17-30-25(31-23)20-12-14-28(15-13-20)26(2,3)4/h6-11,16,20,25H,5,12-15,17H2,1-4H3,(H,27,29) |
| InChIKey | IVPQEZYZBSWAON-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |