C35H50N2O8 — CID 90895910
2-[[4-[[16-(2-hydroxy-3,3-dimethylbutan-2-yl)-15-methoxy-14-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-yl]oxy]-4-oxobutanoyl]amino]-3-methylbutanoic acid (PubChem CID 90895910) has the molecular formula C35H50N2O8 and a molecular weight of 626.79 g/mol. Its IUPAC name is 2-[[4-[[16-(2-hydroxy-3,3-dimethylbutan-2-yl)-15-methoxy-14-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-yl]oxy]-4-oxobutanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[4-[[16-(2-hydroxy-3,3-dimethylbutan-2-yl)-15-methoxy-14-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-yl]oxy]-4-oxobutanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 90895910 |
| Molecular Formula | C35H50N2O8 |
| Molecular Weight | 626.79 g/mol |
| Exact Mass | 626.36 |
| IUPAC Name | 2-[[4-[[16-(2-hydroxy-3,3-dimethylbutan-2-yl)-15-methoxy-14-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-yl]oxy]-4-oxobutanoyl]amino]-3-methylbutanoic acid |
| SMILES | COC12CCC3(CC1C(C)(O)C(C)(C)C)C1Cc4ccc(OC(=O)CCC(=O)NC(C(=O)O)C(C)C)c5c4C3(CCN1)C2(C)O5 |
| InChI | InChI=1S/C35H50N2O8/c1-19(2)27(29(40)41)37-24(38)11-12-25(39)44-21-10-9-20-17-23-33-13-14-35(43-8,22(18-33)31(6,42)30(3,4)5)32(7)34(33,15-16-36-23)26(20)28(21)45-32/h9-10,19,22-23,27,36,42H,11-18H2,1-8H3,(H,37,38)(H,40,41) |
| InChIKey | XOYKDVSSTHOZKT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 143.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.79 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|