C23H23NO3 — CID 90900808
N-[(1R,2S)-2,3-dihydroxy-1-naphthalen-2-ylpropyl]-3-(4-methylphenyl)prop-2-enamide (PubChem CID 90900808) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is N-[(1R,2S)-2,3-dihydroxy-1-naphthalen-2-ylpropyl]-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | N-[(1R,2S)-2,3-dihydroxy-1-naphthalen-2-ylpropyl]-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 90900808 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | N-[(1R,2S)-2,3-dihydroxy-1-naphthalen-2-ylpropyl]-3-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(C=CC(=O)N[C@H](c2ccc3ccccc3c2)[C@H](O)CO)cc1 |
| InChI | InChI=1S/C23H23NO3/c1-16-6-8-17(9-7-16)10-13-22(27)24-23(21(26)15-25)20-12-11-18-4-2-3-5-19(18)14-20/h2-14,21,23,25-26H,15H2,1H3,(H,24,27)/t21-,23-/m1/s1 |
| InChIKey | ZFRDRPWMXMVRPW-FYYLOGMGSA-N |
| XLogP | 3.37 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|