C22H19F2NO3 — CID 90755310
3-(2,3-difluorophenyl)-N-[(1R,2S)-2,3-dihydroxy-1-naphthalen-2-ylpropyl]prop-2-enamide (PubChem CID 90755310) has the molecular formula C22H19F2NO3 and a molecular weight of 383.39 g/mol. Its IUPAC name is 3-(2,3-difluorophenyl)-N-[(1R,2S)-2,3-dihydroxy-1-naphthalen-2-ylpropyl]prop-2-enamide.
| Compound Name | 3-(2,3-difluorophenyl)-N-[(1R,2S)-2,3-dihydroxy-1-naphthalen-2-ylpropyl]prop-2-enamide |
|---|---|
| PubChem CID | 90755310 |
| Molecular Formula | C22H19F2NO3 |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 3-(2,3-difluorophenyl)-N-[(1R,2S)-2,3-dihydroxy-1-naphthalen-2-ylpropyl]prop-2-enamide |
| SMILES | O=C(C=Cc1cccc(F)c1F)N[C@H](c1ccc2ccccc2c1)[C@H](O)CO |
| InChI | InChI=1S/C22H19F2NO3/c23-18-7-3-6-15(21(18)24)10-11-20(28)25-22(19(27)13-26)17-9-8-14-4-1-2-5-16(14)12-17/h1-12,19,22,26-27H,13H2,(H,25,28)/t19-,22-/m1/s1 |
| InChIKey | KMUIUOMSLREFFW-DENIHFKCSA-N |
| XLogP | 3.34 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|