C22H22Cl2N2O2 — CID 90900899
4,5-bis(4-chlorophenyl)hexyl 1H-imidazole-2-carboxylate (PubChem CID 90900899) has the molecular formula C22H22Cl2N2O2 and a molecular weight of 417.34 g/mol. Its IUPAC name is 4,5-bis(4-chlorophenyl)hexyl 1H-imidazole-2-carboxylate.
| Compound Name | 4,5-bis(4-chlorophenyl)hexyl 1H-imidazole-2-carboxylate |
|---|---|
| PubChem CID | 90900899 |
| Molecular Formula | C22H22Cl2N2O2 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 4,5-bis(4-chlorophenyl)hexyl 1H-imidazole-2-carboxylate |
| SMILES | CC(c1ccc(Cl)cc1)C(CCCOC(=O)c1ncc[nH]1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H22Cl2N2O2/c1-15(16-4-8-18(23)9-5-16)20(17-6-10-19(24)11-7-17)3-2-14-28-22(27)21-25-12-13-26-21/h4-13,15,20H,2-3,14H2,1H3,(H,25,26) |
| InChIKey | KFWDSKOYHONKJV-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|