C11H24N2O2 — CID 90901764
(2R,3R)-3-amino-2-hydroxy-1-piperidin-1-ylbutan-1-one;ethane (PubChem CID 90901764) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is (2R,3R)-3-amino-2-hydroxy-1-piperidin-1-ylbutan-1-one;ethane.
| Compound Name | (2R,3R)-3-amino-2-hydroxy-1-piperidin-1-ylbutan-1-one;ethane |
|---|---|
| PubChem CID | 90901764 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | (2R,3R)-3-amino-2-hydroxy-1-piperidin-1-ylbutan-1-one;ethane |
| SMILES | CC.C[C@@H](N)[C@@H](O)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C9H18N2O2.C2H6/c1-7(10)8(12)9(13)11-5-3-2-4-6-11;1-2/h7-8,12H,2-6,10H2,1H3;1-2H3/t7-,8-;/m1./s1 |
| InChIKey | KVKWDZFWPSWIMM-SCLLHFNJSA-N |
| XLogP | 0.73 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |