C36H39N3O3 — CID 90903699
tert-butyl 3-[1-(3,6-diphenylcarbazol-9-yl)-2-hydroxypropyl]piperazine-1-carboxylate (PubChem CID 90903699) has the molecular formula C36H39N3O3 and a molecular weight of 561.73 g/mol. Its IUPAC name is tert-butyl 3-[1-(3,6-diphenylcarbazol-9-yl)-2-hydroxypropyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-[1-(3,6-diphenylcarbazol-9-yl)-2-hydroxypropyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 90903699 |
| Molecular Formula | C36H39N3O3 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.30 |
| IUPAC Name | tert-butyl 3-[1-(3,6-diphenylcarbazol-9-yl)-2-hydroxypropyl]piperazine-1-carboxylate |
| SMILES | CC(O)C(C1CN(C(=O)OC(C)(C)C)CCN1)n1c2ccc(-c3ccccc3)cc2c2cc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C36H39N3O3/c1-24(40)34(31-23-38(20-19-37-31)35(41)42-36(2,3)4)39-32-17-15-27(25-11-7-5-8-12-25)21-29(32)30-22-28(16-18-33(30)39)26-13-9-6-10-14-26/h5-18,21-22,24,31,34,37,40H,19-20,23H2,1-4H3 |
| InChIKey | MYLSFFWSIPDXSV-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |