C35H58O7Si — CID 90904407
4-[(2R,6R)-2-[(2S,10R)-10-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-10-hydroxy-2-methyl-4-methylidene-6-tri(propan-2-yl)silyloxydec-7-enyl]-3,6-dihydro-2H-pyran-6-yl]but-2-ynoic acid (PubChem CID 90904407) has the molecular formula C35H58O7Si and a molecular weight of 618.93 g/mol. Its IUPAC name is 4-[(2R,6R)-2-[(2S,10R)-10-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-10-hydroxy-2-methyl-4-methylidene-6-tri(propan-2-yl)silyloxydec-7-enyl]-3,6-dihydro-2H-pyran-6-yl]but-2-ynoic acid.
| Compound Name | 4-[(2R,6R)-2-[(2S,10R)-10-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-10-hydroxy-2-methyl-4-methylidene-6-tri(propan-2-yl)silyloxydec-7-enyl]-3,6-dihydro-2H-pyran-6-yl]but-2-ynoic acid |
|---|---|
| PubChem CID | 90904407 |
| Molecular Formula | C35H58O7Si |
| Molecular Weight | 618.93 g/mol |
| Exact Mass | 618.40 |
| IUPAC Name | 4-[(2R,6R)-2-[(2S,10R)-10-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-10-hydroxy-2-methyl-4-methylidene-6-tri(propan-2-yl)silyloxydec-7-enyl]-3,6-dihydro-2H-pyran-6-yl]but-2-ynoic acid |
| SMILES | C=C(CC(C=CC[C@@H](O)[C@@H]1COC(C)(C)O1)O[Si](C(C)C)(C(C)C)C(C)C)C[C@H](C)C[C@@H]1CC=C[C@@H](CC#CC(=O)O)O1 |
| InChI | InChI=1S/C35H58O7Si/c1-24(2)43(25(3)4,26(5)6)42-31(17-12-18-32(36)33-23-39-35(9,10)41-33)22-28(8)20-27(7)21-30-16-11-14-29(40-30)15-13-19-34(37)38/h11-12,14,17,24-27,29-33,36H,8,15-16,18,20-23H2,1-7,9-10H3,(H,37,38)/t27-,29-,30-,31?,32+,33-/m0/s1 |
| InChIKey | BHTUNSFMIOEXKV-OLZVRNTQSA-N |
| XLogP | 7.56 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.93 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|