C10H20N2O2 — CID 90904449
3,6-dihydroxy-2,2,4,4,7-pentamethyl-3,6-diazabicyclo[3.2.0]heptane (PubChem CID 90904449) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 3,6-dihydroxy-2,2,4,4,7-pentamethyl-3,6-diazabicyclo[3.2.0]heptane.
| Compound Name | 3,6-dihydroxy-2,2,4,4,7-pentamethyl-3,6-diazabicyclo[3.2.0]heptane |
|---|---|
| PubChem CID | 90904449 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 3,6-dihydroxy-2,2,4,4,7-pentamethyl-3,6-diazabicyclo[3.2.0]heptane |
| SMILES | CC1C2C(N1O)C(C)(C)N(O)C2(C)C |
| InChI | InChI=1S/C10H20N2O2/c1-6-7-8(11(6)13)10(4,5)12(14)9(7,2)3/h6-8,13-14H,1-5H3 |
| InChIKey | ULLQITMIBDTKER-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |