C18H26N2O2 — CID 90905854
1-(4-benzylpiperazin-1-yl)-3-buta-1,3-dien-2-yloxypropan-2-ol (PubChem CID 90905854) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-3-buta-1,3-dien-2-yloxypropan-2-ol.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-3-buta-1,3-dien-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 90905854 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-3-buta-1,3-dien-2-yloxypropan-2-ol |
| SMILES | C=CC(=C)OCC(O)CN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H26N2O2/c1-3-16(2)22-15-18(21)14-20-11-9-19(10-12-20)13-17-7-5-4-6-8-17/h3-8,18,21H,1-2,9-15H2 |
| InChIKey | GJLVNCBTPSPWAL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|