C16H15BrF3N3 — CID 90905959
2-[2-[4-bromo-3-(trifluoromethyl)phenyl]piperidin-1-yl]pyrimidine (PubChem CID 90905959) has the molecular formula C16H15BrF3N3 and a molecular weight of 386.22 g/mol. Its IUPAC name is 2-[2-[4-bromo-3-(trifluoromethyl)phenyl]piperidin-1-yl]pyrimidine.
| Compound Name | 2-[2-[4-bromo-3-(trifluoromethyl)phenyl]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 90905959 |
| Molecular Formula | C16H15BrF3N3 |
| Molecular Weight | 386.22 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 2-[2-[4-bromo-3-(trifluoromethyl)phenyl]piperidin-1-yl]pyrimidine |
| SMILES | FC(F)(F)c1cc(C2CCCCN2c2ncccn2)ccc1Br |
| InChI | InChI=1S/C16H15BrF3N3/c17-13-6-5-11(10-12(13)16(18,19)20)14-4-1-2-9-23(14)15-21-7-3-8-22-15/h3,5-8,10,14H,1-2,4,9H2 |
| InChIKey | SGVHKIASVALEIP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.22 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |