C15H17FN2O4 — CID 90906158
7-tert-butyl-4-fluoro-3-oxospiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-1'-carboxylic acid (PubChem CID 90906158) has the molecular formula C15H17FN2O4 and a molecular weight of 308.31 g/mol. Its IUPAC name is 7-tert-butyl-4-fluoro-3-oxospiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-1'-carboxylic acid.
| Compound Name | 7-tert-butyl-4-fluoro-3-oxospiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-1'-carboxylic acid |
|---|---|
| PubChem CID | 90906158 |
| Molecular Formula | C15H17FN2O4 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 7-tert-butyl-4-fluoro-3-oxospiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-1'-carboxylic acid |
| SMILES | CC(C)(C)c1cnc(F)c2c1C1(CCN(C(=O)O)C1)OC2=O |
| InChI | InChI=1S/C15H17FN2O4/c1-14(2,3)8-6-17-11(16)9-10(8)15(22-12(9)19)4-5-18(7-15)13(20)21/h6H,4-5,7H2,1-3H3,(H,20,21) |
| InChIKey | MBHSQLHWABYHBP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|